Einecs 254-310-8 - Names and Identifiers
Name | 1-amino-2,6-dimethylpiperidine
|
Synonyms | Brn 0079975 Einecs 254-310-8 2,6-dimethylpiperidin-1-amine 2,6-Dimethyl-1-piperidinamine 2,6-dimethyl-1-piperidylamine 1-amino-2,6-dimethyl-piperidin 1-amino-2,6-dimethylpiperidine 2,6-Dimethylpiperidin-1-ylamine 1-Piperidinamine, 2,6-dimethyl- Piperidine, 1-amino-2,6-dimethyl-
|
CAS | 39135-39-2
|
EINECS | 254-310-8 |
InChI | InChI=1/C7H16N2/c1-6-4-3-5-7(2)9(6)8/h6-7H,3-5,8H2,1-2H3 |
Einecs 254-310-8 - Physico-chemical Properties
Molecular Formula | C7H16N2
|
Molar Mass | 128.22 |
Density | 0.865 g/mL at 25 °C (lit.) |
Boling Point | 65-80 °C/30 mmHg (lit.) |
Flash Point | 108°F |
Vapor Presure | 2.45mmHg at 25°C |
pKa | 8.23±0.60(Predicted) |
Storage Condition | Room Temprature |
Refractive Index | n20/D 1.465(lit.) |
Einecs 254-310-8 - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | R10 - Flammable
R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed.
R36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S16 - Keep away from sources of ignition.
S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S27 - Take off immediately all contaminated clothing.
S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
|
UN IDs | UN 1993 3/PG 3 |
WGK Germany | 3 |
RTECS | TM4175000 |
Hazard Class | 3.2 |
Packing Group | III |
Einecs 254-310-8 - Introduction
1-amino-2,6-dimethylpiperidine(1-amino-2,6-dimethylpiperidine) is an organic compound with the chemical formula C8H18N. It has some of the following properties:
1. Appearance: 1-amino-2,6-dimethylpiperidine is a colorless to light yellow liquid.
2. Solubility: It can be dissolved in water and some organic solvents, such as alcohols and ethers.
3. Melting point and boiling point: Its melting point is about -40°C, and its boiling point is about 146-148°C.
4. Isomer: 1-amino-2,6-dimethylpiperidine has two stereoisomers, namely (R)-and (S)-, and their configurations are called RR and SS respectively.
1-amino-2,6-dimethylpiperidine has a series of applications in organic synthesis:
1. Used as an intermediate: It can be used as an intermediate in the synthesis of dyes, medicines and pesticides.
2. Catalyst: It can be used as a catalyst for hydrogenation and reduction reactions.
3. coordination reagent: it can form complexes with metal, used in catalysis, optoelectronics and materials science.
The preparation of 1-amino-2,6-dimethylpiperidine is usually achieved through the following steps:
1.1-amino-2,6-dimethylpiperidine was obtained by the reaction of ammonia water and 2,6-dimethylpiperidine.
When using and handling 1-amino-2,6-dimethylpiperidine, you need to pay attention to the following safety information:
1. Toxicity: 1-amino-2,6-dimethylpiperidine is a toxic compound, do not breathe its vapor or contact with skin and eyes.
2. Ignition: It has a certain degree of ignition and explosiveness, and should be kept away from open flames and high temperatures.
3. Storage: It should be stored in a cool, ventilated and away from fire.
Last Update:2024-04-09 21:21:28